C19H13Cl2NO4S — CID 23451148
4-[6-(3,5-dichlorophenyl)-1,3-benzodioxol-5-yl]benzenesulfonamide (PubChem CID 23451148) has the molecular formula C19H13Cl2NO4S and a molecular weight of 422.29 g/mol. Its IUPAC name is 4-[6-(3,5-dichlorophenyl)-1,3-benzodioxol-5-yl]benzenesulfonamide.
| Compound Name | 4-[6-(3,5-dichlorophenyl)-1,3-benzodioxol-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 23451148 |
| Molecular Formula | C19H13Cl2NO4S |
| Molecular Weight | 422.29 g/mol |
| Exact Mass | 420.99 |
| IUPAC Name | 4-[6-(3,5-dichlorophenyl)-1,3-benzodioxol-5-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-c2cc3c(cc2-c2cc(Cl)cc(Cl)c2)OCO3)cc1 |
| InChI | InChI=1S/C19H13Cl2NO4S/c20-13-5-12(6-14(21)7-13)17-9-19-18(25-10-26-19)8-16(17)11-1-3-15(4-2-11)27(22,23)24/h1-9H,10H2,(H2,22,23,24) |
| InChIKey | GWICFELXVVILAF-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.29 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |