C22H17NO5S — CID 142639479
4-[3-(1,3-benzodioxol-5-yl)-4H-chromen-2-yl]benzenesulfonamide (PubChem CID 142639479) has the molecular formula C22H17NO5S and a molecular weight of 407.45 g/mol. Its IUPAC name is 4-[3-(1,3-benzodioxol-5-yl)-4H-chromen-2-yl]benzenesulfonamide.
| Compound Name | 4-[3-(1,3-benzodioxol-5-yl)-4H-chromen-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 142639479 |
| Molecular Formula | C22H17NO5S |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | 4-[3-(1,3-benzodioxol-5-yl)-4H-chromen-2-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(C2=C(c3ccc4c(c3)OCO4)Cc3ccccc3O2)cc1 |
| InChI | InChI=1S/C22H17NO5S/c23-29(24,25)17-8-5-14(6-9-17)22-18(11-16-3-1-2-4-19(16)28-22)15-7-10-20-21(12-15)27-13-26-20/h1-10,12H,11,13H2,(H2,23,24,25) |
| InChIKey | DEURTHLSYUPIBF-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|