C25H25NO4S — CID 142639580
4-[3-(4-methoxy-3-propylphenyl)-4H-chromen-2-yl]benzenesulfonamide (PubChem CID 142639580) has the molecular formula C25H25NO4S and a molecular weight of 435.55 g/mol. Its IUPAC name is 4-[3-(4-methoxy-3-propylphenyl)-4H-chromen-2-yl]benzenesulfonamide.
| Compound Name | 4-[3-(4-methoxy-3-propylphenyl)-4H-chromen-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 142639580 |
| Molecular Formula | C25H25NO4S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 4-[3-(4-methoxy-3-propylphenyl)-4H-chromen-2-yl]benzenesulfonamide |
| SMILES | CCCc1cc(C2=C(c3ccc(S(N)(=O)=O)cc3)Oc3ccccc3C2)ccc1OC |
| InChI | InChI=1S/C25H25NO4S/c1-3-6-19-15-18(11-14-23(19)29-2)22-16-20-7-4-5-8-24(20)30-25(22)17-9-12-21(13-10-17)31(26,27)28/h4-5,7-15H,3,6,16H2,1-2H3,(H2,26,27,28) |
| InChIKey | YZEIVBLEOWAXDP-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|