C12H15N3O4S — CID 50747503
4-methoxy-3-(3-propyl-1,2,4-oxadiazol-5-yl)benzenesulfonamide (PubChem CID 50747503) has the molecular formula C12H15N3O4S and a molecular weight of 297.34 g/mol. Its IUPAC name is 4-methoxy-3-(3-propyl-1,2,4-oxadiazol-5-yl)benzenesulfonamide.
| Compound Name | 4-methoxy-3-(3-propyl-1,2,4-oxadiazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 50747503 |
| Molecular Formula | C12H15N3O4S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 4-methoxy-3-(3-propyl-1,2,4-oxadiazol-5-yl)benzenesulfonamide |
| SMILES | CCCc1noc(-c2cc(S(N)(=O)=O)ccc2OC)n1 |
| InChI | InChI=1S/C12H15N3O4S/c1-3-4-11-14-12(19-15-11)9-7-8(20(13,16)17)5-6-10(9)18-2/h5-7H,3-4H2,1-2H3,(H2,13,16,17) |
| InChIKey | ZYWPOOSPUOYRDE-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |