C15H19N3O4S — CID 50747537
3-(5-cyclohexyl-1,2,4-oxadiazol-3-yl)-4-methoxybenzenesulfonamide (PubChem CID 50747537) has the molecular formula C15H19N3O4S and a molecular weight of 337.40 g/mol. Its IUPAC name is 3-(5-cyclohexyl-1,2,4-oxadiazol-3-yl)-4-methoxybenzenesulfonamide.
| Compound Name | 3-(5-cyclohexyl-1,2,4-oxadiazol-3-yl)-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 50747537 |
| Molecular Formula | C15H19N3O4S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 3-(5-cyclohexyl-1,2,4-oxadiazol-3-yl)-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(N)(=O)=O)cc1-c1noc(C2CCCCC2)n1 |
| InChI | InChI=1S/C15H19N3O4S/c1-21-13-8-7-11(23(16,19)20)9-12(13)14-17-15(22-18-14)10-5-3-2-4-6-10/h7-10H,2-6H2,1H3,(H2,16,19,20) |
| InChIKey | CHJINZXTZHBQFL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |