C16H20N2O3 — CID 957265
5-cyclohexyl-3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazole (PubChem CID 957265) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 5-cyclohexyl-3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazole.
| Compound Name | 5-cyclohexyl-3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 957265 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 5-cyclohexyl-3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazole |
| SMILES | COc1ccc(-c2noc(C3CCCCC3)n2)cc1OC |
| InChI | InChI=1S/C16H20N2O3/c1-19-13-9-8-12(10-14(13)20-2)15-17-16(21-18-15)11-6-4-3-5-7-11/h8-11H,3-7H2,1-2H3 |
| InChIKey | WVSYZVOJGICCSU-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |