C17H20N2O3 — CID 42851452
5-cyclopentyl-3-(3-methoxy-4-prop-2-enoxyphenyl)-1,2,4-oxadiazole (PubChem CID 42851452) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is 5-cyclopentyl-3-(3-methoxy-4-prop-2-enoxyphenyl)-1,2,4-oxadiazole.
| Compound Name | 5-cyclopentyl-3-(3-methoxy-4-prop-2-enoxyphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 42851452 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 5-cyclopentyl-3-(3-methoxy-4-prop-2-enoxyphenyl)-1,2,4-oxadiazole |
| SMILES | C=CCOc1ccc(-c2noc(C3CCCC3)n2)cc1OC |
| InChI | InChI=1S/C17H20N2O3/c1-3-10-21-14-9-8-13(11-15(14)20-2)16-18-17(22-19-16)12-6-4-5-7-12/h3,8-9,11-12H,1,4-7,10H2,2H3 |
| InChIKey | XWOKSHDIXGTJDI-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|