C17H22N2O4 — CID 847024
5-cyclohexyl-3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazole (PubChem CID 847024) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is 5-cyclohexyl-3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazole.
| Compound Name | 5-cyclohexyl-3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 847024 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 5-cyclohexyl-3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazole |
| SMILES | COc1cc(-c2noc(C3CCCCC3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C17H22N2O4/c1-20-13-9-12(10-14(21-2)15(13)22-3)16-18-17(23-19-16)11-7-5-4-6-8-11/h9-11H,4-8H2,1-3H3 |
| InChIKey | VONITYIPLRGGIQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 66.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |