About 5-[1-(benzenesulfonyl)piperidin-4-yl]-3-(2-methoxyphenyl)-1,2,4-oxadiazole
5-[1-(benzenesulfonyl)piperidin-4-yl]-3-(2-methoxyphenyl)-1,2,4-oxadiazole (PubChem CID 2986760) has the molecular formula C20H21N3O4S
and a molecular weight of 399.47 g/mol. Its IUPAC name is 5-[1-(benzenesulfonyl)piperidin-4-yl]-3-(2-methoxyphenyl)-1,2,4-oxadiazole.
Molecular Properties
| Compound Name | 5-[1-(benzenesulfonyl)piperidin-4-yl]-3-(2-methoxyphenyl)-1,2,4-oxadiazole |
| PubChem CID | 2986760 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 5-[1-(benzenesulfonyl)piperidin-4-yl]-3-(2-methoxyphenyl)-1,2,4-oxadiazole |
| SMILES | COc1ccccc1-c1noc(C2CCN(S(=O)(=O)c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C20H21N3O4S/c1-26-18-10-6-5-9-17(18)19-21-20(27-22-19)15-11-13-23(14-12-15)28(24,25)16-7-3-2-4-8-16/h2-10,15H,11-14H2,1H3 |
| InChIKey | QXRGGHAQSRABFI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 85.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[1-(benzenesulfonyl)piperidin-4-yl]-3-(2-methoxyphenyl)-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-(benzenesulfonyl)piperidin-4-yl]-3-(2-methoxyphenyl)-1,2,4-oxadiazole?
The IUPAC name of 5-[1-(benzenesulfonyl)piperidin-4-yl]-3-(2-methoxyphenyl)-1,2,4-oxadiazole (CID 2986760) is 5-[1-(benzenesulfonyl)piperidin-4-yl]-3-(2-methoxyphenyl)-1,2,4-oxadiazole.
What is the SMILES notation for 5-[1-(benzenesulfonyl)piperidin-4-yl]-3-(2-methoxyphenyl)-1,2,4-oxadiazole?
The canonical SMILES for 5-[1-(benzenesulfonyl)piperidin-4-yl]-3-(2-methoxyphenyl)-1,2,4-oxadiazole is COc1ccccc1-c1noc(C2CCN(S(=O)(=O)c3ccccc3)CC2)n1.
What is the InChIKey of 5-[1-(benzenesulfonyl)piperidin-4-yl]-3-(2-methoxyphenyl)-1,2,4-oxadiazole?
The InChIKey is QXRGGHAQSRABFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N3O4S/c1-26-18-10-6-5-9-17(18)19-21-20(27-22-19)15-11-13-23(14-12-15)28(24,25)16-7-3-2-4-8-16/h2-10,15H,11-14H2,1H3.
What are the key properties of 5-[1-(benzenesulfonyl)piperidin-4-yl]-3-(2-methoxyphenyl)-1,2,4-oxadiazole?
5-[1-(benzenesulfonyl)piperidin-4-yl]-3-(2-methoxyphenyl)-1,2,4-oxadiazole has a molecular weight of 399.47 g/mol, XLogP of 3.31, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-(benzenesulfonyl)piperidin-4-yl]-3-(2-methoxyphenyl)-1,2,4-oxadiazole is sourced from PubChem (CID 2986760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).