C19H12ClF2NO4S — CID 67655287
2-[6-(4-chloro-3,5-difluorophenyl)-1,3-benzodioxol-5-yl]benzenesulfonamide (PubChem CID 67655287) has the molecular formula C19H12ClF2NO4S and a molecular weight of 423.82 g/mol. Its IUPAC name is 2-[6-(4-chloro-3,5-difluorophenyl)-1,3-benzodioxol-5-yl]benzenesulfonamide.
| Compound Name | 2-[6-(4-chloro-3,5-difluorophenyl)-1,3-benzodioxol-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 67655287 |
| Molecular Formula | C19H12ClF2NO4S |
| Molecular Weight | 423.82 g/mol |
| Exact Mass | 423.01 |
| IUPAC Name | 2-[6-(4-chloro-3,5-difluorophenyl)-1,3-benzodioxol-5-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccccc1-c1cc2c(cc1-c1cc(F)c(Cl)c(F)c1)OCO2 |
| InChI | InChI=1S/C19H12ClF2NO4S/c20-19-14(21)5-10(6-15(19)22)12-7-16-17(27-9-26-16)8-13(12)11-3-1-2-4-18(11)28(23,24)25/h1-8H,9H2,(H2,23,24,25) |
| InChIKey | CHSWJOVHFNRFCC-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.82 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|