C21H18F3NO4S — CID 23217411
2-[2-[3,5-dimethoxy-4-(trifluoromethyl)phenyl]phenyl]benzenesulfonamide (PubChem CID 23217411) has the molecular formula C21H18F3NO4S and a molecular weight of 437.44 g/mol. Its IUPAC name is 2-[2-[3,5-dimethoxy-4-(trifluoromethyl)phenyl]phenyl]benzenesulfonamide.
| Compound Name | 2-[2-[3,5-dimethoxy-4-(trifluoromethyl)phenyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 23217411 |
| Molecular Formula | C21H18F3NO4S |
| Molecular Weight | 437.44 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | 2-[2-[3,5-dimethoxy-4-(trifluoromethyl)phenyl]phenyl]benzenesulfonamide |
| SMILES | COc1cc(-c2ccccc2-c2ccccc2S(N)(=O)=O)cc(OC)c1C(F)(F)F |
| InChI | InChI=1S/C21H18F3NO4S/c1-28-17-11-13(12-18(29-2)20(17)21(22,23)24)14-7-3-4-8-15(14)16-9-5-6-10-19(16)30(25,26)27/h3-12H,1-2H3,(H2,25,26,27) |
| InChIKey | AJTWTBDSCIIPDJ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.44 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |