About 2-[2-[3,5-dimethoxy-4-(trifluoromethyl)phenyl]phenyl]benzenesulfonamide
2-[2-[3,5-dimethoxy-4-(trifluoromethyl)phenyl]phenyl]benzenesulfonamide (PubChem CID 23217411) has the molecular formula C21H18F3NO4S
and a molecular weight of 437.44 g/mol. Its IUPAC name is 2-[2-[3,5-dimethoxy-4-(trifluoromethyl)phenyl]phenyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 2-[2-[3,5-dimethoxy-4-(trifluoromethyl)phenyl]phenyl]benzenesulfonamide |
| PubChem CID | 23217411 |
| Molecular Formula | C21H18F3NO4S |
| Molecular Weight | 437.44 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | 2-[2-[3,5-dimethoxy-4-(trifluoromethyl)phenyl]phenyl]benzenesulfonamide |
| SMILES | COc1cc(-c2ccccc2-c2ccccc2S(N)(=O)=O)cc(OC)c1C(F)(F)F |
| InChI | InChI=1S/C21H18F3NO4S/c1-28-17-11-13(12-18(29-2)20(17)21(22,23)24)14-7-3-4-8-15(14)16-9-5-6-10-19(16)30(25,26)27/h3-12H,1-2H3,(H2,25,26,27) |
| InChIKey | AJTWTBDSCIIPDJ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.44 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-[3,5-dimethoxy-4-(trifluoromethyl)phenyl]phenyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[3,5-dimethoxy-4-(trifluoromethyl)phenyl]phenyl]benzenesulfonamide?
The IUPAC name of 2-[2-[3,5-dimethoxy-4-(trifluoromethyl)phenyl]phenyl]benzenesulfonamide (CID 23217411) is 2-[2-[3,5-dimethoxy-4-(trifluoromethyl)phenyl]phenyl]benzenesulfonamide.
What is the SMILES notation for 2-[2-[3,5-dimethoxy-4-(trifluoromethyl)phenyl]phenyl]benzenesulfonamide?
The canonical SMILES for 2-[2-[3,5-dimethoxy-4-(trifluoromethyl)phenyl]phenyl]benzenesulfonamide is COc1cc(-c2ccccc2-c2ccccc2S(N)(=O)=O)cc(OC)c1C(F)(F)F.
What is the InChIKey of 2-[2-[3,5-dimethoxy-4-(trifluoromethyl)phenyl]phenyl]benzenesulfonamide?
The InChIKey is AJTWTBDSCIIPDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18F3NO4S/c1-28-17-11-13(12-18(29-2)20(17)21(22,23)24)14-7-3-4-8-15(14)16-9-5-6-10-19(16)30(25,26)27/h3-12H,1-2H3,(H2,25,26,27).
What are the key properties of 2-[2-[3,5-dimethoxy-4-(trifluoromethyl)phenyl]phenyl]benzenesulfonamide?
2-[2-[3,5-dimethoxy-4-(trifluoromethyl)phenyl]phenyl]benzenesulfonamide has a molecular weight of 437.44 g/mol, XLogP of 4.70, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[3,5-dimethoxy-4-(trifluoromethyl)phenyl]phenyl]benzenesulfonamide is sourced from PubChem (CID 23217411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).