C23H20ClN5O5S — CID 22505133
1-[4-[5-(3-chloro-4-methoxyphenyl)-1-(2-sulfamoylphenyl)pyrazol-3-yl]phenyl]-1-hydroxyurea (PubChem CID 22505133) has the molecular formula C23H20ClN5O5S and a molecular weight of 513.96 g/mol. Its IUPAC name is 1-[4-[5-(3-chloro-4-methoxyphenyl)-1-(2-sulfamoylphenyl)pyrazol-3-yl]phenyl]-1-hydroxyurea.
| Compound Name | 1-[4-[5-(3-chloro-4-methoxyphenyl)-1-(2-sulfamoylphenyl)pyrazol-3-yl]phenyl]-1-hydroxyurea |
|---|---|
| PubChem CID | 22505133 |
| Molecular Formula | C23H20ClN5O5S |
| Molecular Weight | 513.96 g/mol |
| Exact Mass | 513.09 |
| IUPAC Name | 1-[4-[5-(3-chloro-4-methoxyphenyl)-1-(2-sulfamoylphenyl)pyrazol-3-yl]phenyl]-1-hydroxyurea |
| SMILES | COc1ccc(-c2cc(-c3ccc(N(O)C(N)=O)cc3)nn2-c2ccccc2S(N)(=O)=O)cc1Cl |
| InChI | InChI=1S/C23H20ClN5O5S/c1-34-21-11-8-15(12-17(21)24)20-13-18(14-6-9-16(10-7-14)29(31)23(25)30)27-28(20)19-4-2-3-5-22(19)35(26,32)33/h2-13,31H,1H3,(H2,25,30)(H2,26,32,33) |
| InChIKey | CCSCVMZLLPPMJJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 153.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.96 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|