C27H20ClN5O6S — CID 127051924
N-[(E)-(4-chloro-2-oxochromen-3-yl)methylideneamino]-5-(4-methoxyphenyl)-1-(4-sulfamoylphenyl)pyrazole-3-carboxamide (PubChem CID 127051924) has the molecular formula C27H20ClN5O6S and a molecular weight of 578.01 g/mol. Its IUPAC name is N-[(E)-(4-chloro-2-oxochromen-3-yl)methylideneamino]-5-(4-methoxyphenyl)-1-(4-sulfamoylphenyl)pyrazole-3-carboxamide.
| Compound Name | N-[(E)-(4-chloro-2-oxochromen-3-yl)methylideneamino]-5-(4-methoxyphenyl)-1-(4-sulfamoylphenyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 127051924 |
| Molecular Formula | C27H20ClN5O6S |
| Molecular Weight | 578.01 g/mol |
| Exact Mass | 577.08 |
| IUPAC Name | N-[(E)-(4-chloro-2-oxochromen-3-yl)methylideneamino]-5-(4-methoxyphenyl)-1-(4-sulfamoylphenyl)pyrazole-3-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)N/N=C/c3c(Cl)c4ccccc4oc3=O)nn2-c2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C27H20ClN5O6S/c1-38-18-10-6-16(7-11-18)23-14-22(32-33(23)17-8-12-19(13-9-17)40(29,36)37)26(34)31-30-15-21-25(28)20-4-2-3-5-24(20)39-27(21)35/h2-15H,1H3,(H,31,34)(H2,29,36,37)/b30-15+ |
| InChIKey | WTKXNYQLUXPOLK-FJEPWZHXSA-N |
| XLogP | 3.72 |
| TPSA | 158.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.01 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|