C28H22ClN5O6S — CID 127051106
N-[(E)-(4-chloro-2-oxochromen-3-yl)methylideneamino]-5-(4-ethoxyphenyl)-1-(4-sulfamoylphenyl)pyrazole-3-carboxamide (PubChem CID 127051106) has the molecular formula C28H22ClN5O6S and a molecular weight of 592.03 g/mol. Its IUPAC name is N-[(E)-(4-chloro-2-oxochromen-3-yl)methylideneamino]-5-(4-ethoxyphenyl)-1-(4-sulfamoylphenyl)pyrazole-3-carboxamide.
| Compound Name | N-[(E)-(4-chloro-2-oxochromen-3-yl)methylideneamino]-5-(4-ethoxyphenyl)-1-(4-sulfamoylphenyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 127051106 |
| Molecular Formula | C28H22ClN5O6S |
| Molecular Weight | 592.03 g/mol |
| Exact Mass | 591.10 |
| IUPAC Name | N-[(E)-(4-chloro-2-oxochromen-3-yl)methylideneamino]-5-(4-ethoxyphenyl)-1-(4-sulfamoylphenyl)pyrazole-3-carboxamide |
| SMILES | CCOc1ccc(-c2cc(C(=O)N/N=C/c3c(Cl)c4ccccc4oc3=O)nn2-c2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C28H22ClN5O6S/c1-2-39-19-11-7-17(8-12-19)24-15-23(33-34(24)18-9-13-20(14-10-18)41(30,37)38)27(35)32-31-16-22-26(29)21-5-3-4-6-25(21)40-28(22)36/h3-16H,2H2,1H3,(H,32,35)(H2,30,37,38)/b31-16+ |
| InChIKey | KQBTWCZJNAENTC-WCMJOSRZSA-N |
| XLogP | 4.11 |
| TPSA | 158.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.03 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|