C25H30N4O6S — CID 155551691
3-morpholin-4-ylpropyl 5-(4-ethoxyphenyl)-1-(4-sulfamoylphenyl)pyrazole-3-carboxylate (PubChem CID 155551691) has the molecular formula C25H30N4O6S and a molecular weight of 514.60 g/mol. Its IUPAC name is 3-morpholin-4-ylpropyl 5-(4-ethoxyphenyl)-1-(4-sulfamoylphenyl)pyrazole-3-carboxylate.
| Compound Name | 3-morpholin-4-ylpropyl 5-(4-ethoxyphenyl)-1-(4-sulfamoylphenyl)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 155551691 |
| Molecular Formula | C25H30N4O6S |
| Molecular Weight | 514.60 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | 3-morpholin-4-ylpropyl 5-(4-ethoxyphenyl)-1-(4-sulfamoylphenyl)pyrazole-3-carboxylate |
| SMILES | CCOc1ccc(-c2cc(C(=O)OCCCN3CCOCC3)nn2-c2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C25H30N4O6S/c1-2-34-21-8-4-19(5-9-21)24-18-23(25(30)35-15-3-12-28-13-16-33-17-14-28)27-29(24)20-6-10-22(11-7-20)36(26,31)32/h4-11,18H,2-3,12-17H2,1H3,(H2,26,31,32) |
| InChIKey | OQDFOVAJWLYIQE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 125.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.60 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|