C27H20ClN5O5S — CID 127049136
N-[(E)-(4-chloro-2-oxochromen-3-yl)methylideneamino]-5-(3-methylphenyl)-1-(4-sulfamoylphenyl)pyrazole-3-carboxamide (PubChem CID 127049136) has the molecular formula C27H20ClN5O5S and a molecular weight of 562.01 g/mol. Its IUPAC name is N-[(E)-(4-chloro-2-oxochromen-3-yl)methylideneamino]-5-(3-methylphenyl)-1-(4-sulfamoylphenyl)pyrazole-3-carboxamide.
| Compound Name | N-[(E)-(4-chloro-2-oxochromen-3-yl)methylideneamino]-5-(3-methylphenyl)-1-(4-sulfamoylphenyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 127049136 |
| Molecular Formula | C27H20ClN5O5S |
| Molecular Weight | 562.01 g/mol |
| Exact Mass | 561.09 |
| IUPAC Name | N-[(E)-(4-chloro-2-oxochromen-3-yl)methylideneamino]-5-(3-methylphenyl)-1-(4-sulfamoylphenyl)pyrazole-3-carboxamide |
| SMILES | Cc1cccc(-c2cc(C(=O)N/N=C/c3c(Cl)c4ccccc4oc3=O)nn2-c2ccc(S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C27H20ClN5O5S/c1-16-5-4-6-17(13-16)23-14-22(32-33(23)18-9-11-19(12-10-18)39(29,36)37)26(34)31-30-15-21-25(28)20-7-2-3-8-24(20)38-27(21)35/h2-15H,1H3,(H,31,34)(H2,29,36,37)/b30-15+ |
| InChIKey | HAYNMANUJNGMAK-FJEPWZHXSA-N |
| XLogP | 4.02 |
| TPSA | 149.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.01 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|