C31H26N4O3 — CID 137059532
N-[(Z)-(2-hydroxy-3-methoxyphenyl)methylideneamino]-1-(3-methylphenyl)-5-(4-phenylphenyl)pyrazole-3-carboxamide (PubChem CID 137059532) has the molecular formula C31H26N4O3 and a molecular weight of 502.57 g/mol. Its IUPAC name is N-[(Z)-(2-hydroxy-3-methoxyphenyl)methylideneamino]-1-(3-methylphenyl)-5-(4-phenylphenyl)pyrazole-3-carboxamide.
| Compound Name | N-[(Z)-(2-hydroxy-3-methoxyphenyl)methylideneamino]-1-(3-methylphenyl)-5-(4-phenylphenyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 137059532 |
| Molecular Formula | C31H26N4O3 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | N-[(Z)-(2-hydroxy-3-methoxyphenyl)methylideneamino]-1-(3-methylphenyl)-5-(4-phenylphenyl)pyrazole-3-carboxamide |
| SMILES | COc1cccc(/C=N\NC(=O)c2cc(-c3ccc(-c4ccccc4)cc3)n(-c3cccc(C)c3)n2)c1O |
| InChI | InChI=1S/C31H26N4O3/c1-21-8-6-12-26(18-21)35-28(24-16-14-23(15-17-24)22-9-4-3-5-10-22)19-27(34-35)31(37)33-32-20-25-11-7-13-29(38-2)30(25)36/h3-20,36H,1-2H3,(H,33,37)/b32-20- |
| InChIKey | AOHRPBKAGDSJKJ-RGXNXFOYSA-N |
| XLogP | 5.99 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|