C26H25N5O5S — CID 135642323
2-[[5-(3,4-dimethoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]acetamide (PubChem CID 135642323) has the molecular formula C26H25N5O5S and a molecular weight of 519.58 g/mol. Its IUPAC name is 2-[[5-(3,4-dimethoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[[5-(3,4-dimethoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 135642323 |
| Molecular Formula | C26H25N5O5S |
| Molecular Weight | 519.58 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | 2-[[5-(3,4-dimethoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(-c2nnc(SCC(=O)N/N=C/c3cccc(OC)c3O)n2-c2ccccc2)cc1OC |
| InChI | InChI=1S/C26H25N5O5S/c1-34-20-13-12-17(14-22(20)36-3)25-29-30-26(31(25)19-9-5-4-6-10-19)37-16-23(32)28-27-15-18-8-7-11-21(35-2)24(18)33/h4-15,33H,16H2,1-3H3,(H,28,32)/b27-15+ |
| InChIKey | GNNMEAYGPWXLBX-JFLMPSFJSA-N |
| XLogP | 3.91 |
| TPSA | 120.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.58 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|