C30H29N7O3S — CID 5442045
2-[[5-(3,4-dimethoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]acetamide (PubChem CID 5442045) has the molecular formula C30H29N7O3S and a molecular weight of 567.68 g/mol. Its IUPAC name is 2-[[5-(3,4-dimethoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]acetamide.
| Compound Name | 2-[[5-(3,4-dimethoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 5442045 |
| Molecular Formula | C30H29N7O3S |
| Molecular Weight | 567.68 g/mol |
| Exact Mass | 567.21 |
| IUPAC Name | 2-[[5-(3,4-dimethoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]acetamide |
| SMILES | COc1ccc(-c2nnc(SCC(=O)N/N=C\c3c(C)nn(-c4ccccc4)c3C)n2-c2ccccc2)cc1OC |
| InChI | InChI=1S/C30H29N7O3S/c1-20-25(21(2)37(35-20)24-13-9-6-10-14-24)18-31-32-28(38)19-41-30-34-33-29(36(30)23-11-7-5-8-12-23)22-15-16-26(39-3)27(17-22)40-4/h5-18H,19H2,1-4H3,(H,32,38)/b31-18- |
| InChIKey | RDZHRCXQMXJBBT-MNBJERMJSA-N |
| XLogP | 5.00 |
| TPSA | 108.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.68 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|