C29H27N7O2S — CID 4505351
N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]-2-[[5-(4-methoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 4505351) has the molecular formula C29H27N7O2S and a molecular weight of 537.65 g/mol. Its IUPAC name is N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]-2-[[5-(4-methoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]-2-[[5-(4-methoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 4505351 |
| Molecular Formula | C29H27N7O2S |
| Molecular Weight | 537.65 g/mol |
| Exact Mass | 537.19 |
| IUPAC Name | N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]-2-[[5-(4-methoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | COc1ccc(-c2nnc(SCC(=O)NN=Cc3c(C)nn(-c4ccccc4)c3C)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H27N7O2S/c1-20-26(21(2)36(34-20)24-12-8-5-9-13-24)18-30-31-27(37)19-39-29-33-32-28(22-14-16-25(38-3)17-15-22)35(29)23-10-6-4-7-11-23/h4-18H,19H2,1-3H3,(H,31,37) |
| InChIKey | TUUDYTAQLMUURN-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 99.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.65 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|