C18H13N3O5S — CID 162670137
5-(1-benzofuran-2-yl)-1-(4-sulfamoylphenyl)pyrazole-3-carboxylic acid (PubChem CID 162670137) has the molecular formula C18H13N3O5S and a molecular weight of 383.39 g/mol. Its IUPAC name is 5-(1-benzofuran-2-yl)-1-(4-sulfamoylphenyl)pyrazole-3-carboxylic acid.
| Compound Name | 5-(1-benzofuran-2-yl)-1-(4-sulfamoylphenyl)pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 162670137 |
| Molecular Formula | C18H13N3O5S |
| Molecular Weight | 383.39 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | 5-(1-benzofuran-2-yl)-1-(4-sulfamoylphenyl)pyrazole-3-carboxylic acid |
| SMILES | NS(=O)(=O)c1ccc(-n2nc(C(=O)O)cc2-c2cc3ccccc3o2)cc1 |
| InChI | InChI=1S/C18H13N3O5S/c19-27(24,25)13-7-5-12(6-8-13)21-15(10-14(20-21)18(22)23)17-9-11-3-1-2-4-16(11)26-17/h1-10H,(H,22,23)(H2,19,24,25) |
| InChIKey | NKNOCDGADWDMTB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 128.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |