C25H19N5O2S — CID 25156346
1-[[5-(1-benzofuran-2-yl)-1-phenylpyrazole-3-carbonyl]amino]-3-phenylthiourea (PubChem CID 25156346) has the molecular formula C25H19N5O2S and a molecular weight of 453.53 g/mol. Its IUPAC name is 1-[[5-(1-benzofuran-2-yl)-1-phenylpyrazole-3-carbonyl]amino]-3-phenylthiourea.
| Compound Name | 1-[[5-(1-benzofuran-2-yl)-1-phenylpyrazole-3-carbonyl]amino]-3-phenylthiourea |
|---|---|
| PubChem CID | 25156346 |
| Molecular Formula | C25H19N5O2S |
| Molecular Weight | 453.53 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | 1-[[5-(1-benzofuran-2-yl)-1-phenylpyrazole-3-carbonyl]amino]-3-phenylthiourea |
| SMILES | O=C(NNC(=S)Nc1ccccc1)c1cc(-c2cc3ccccc3o2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C25H19N5O2S/c31-24(27-28-25(33)26-18-10-3-1-4-11-18)20-16-21(30(29-20)19-12-5-2-6-13-19)23-15-17-9-7-8-14-22(17)32-23/h1-16H,(H,27,31)(H2,26,28,33) |
| InChIKey | NGFHXOPCAATTDH-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 84.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.53 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_urea_C(9)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|