C13H15N5OS — CID 842923
1-[(1,3-dimethylpyrazole-4-carbonyl)amino]-3-phenylthiourea (PubChem CID 842923) has the molecular formula C13H15N5OS and a molecular weight of 289.36 g/mol. Its IUPAC name is 1-[(1,3-dimethylpyrazole-4-carbonyl)amino]-3-phenylthiourea.
| Compound Name | 1-[(1,3-dimethylpyrazole-4-carbonyl)amino]-3-phenylthiourea |
|---|---|
| PubChem CID | 842923 |
| Molecular Formula | C13H15N5OS |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 1-[(1,3-dimethylpyrazole-4-carbonyl)amino]-3-phenylthiourea |
| SMILES | Cc1nn(C)cc1C(=O)NNC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C13H15N5OS/c1-9-11(8-18(2)17-9)12(19)15-16-13(20)14-10-6-4-3-5-7-10/h3-8H,1-2H3,(H,15,19)(H2,14,16,20) |
| InChIKey | SGADSCLONRRFKH-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 70.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|