C13H16N4O — CID 102805405
2-[(1,3-dimethylpyrazol-4-yl)amino]-N-phenylacetamide (PubChem CID 102805405) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is 2-[(1,3-dimethylpyrazol-4-yl)amino]-N-phenylacetamide.
| Compound Name | 2-[(1,3-dimethylpyrazol-4-yl)amino]-N-phenylacetamide |
|---|---|
| PubChem CID | 102805405 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 2-[(1,3-dimethylpyrazol-4-yl)amino]-N-phenylacetamide |
| SMILES | Cc1nn(C)cc1NCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C13H16N4O/c1-10-12(9-17(2)16-10)14-8-13(18)15-11-6-4-3-5-7-11/h3-7,9,14H,8H2,1-2H3,(H,15,18) |
| InChIKey | ZCDQLEONVNAWSS-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |