C17H13BrN4OS — CID 26956955
1-(3-bromophenyl)-3-(quinoline-2-carbonylamino)thiourea (PubChem CID 26956955) has the molecular formula C17H13BrN4OS and a molecular weight of 401.29 g/mol. Its IUPAC name is 1-(3-bromophenyl)-3-(quinoline-2-carbonylamino)thiourea.
| Compound Name | 1-(3-bromophenyl)-3-(quinoline-2-carbonylamino)thiourea |
|---|---|
| PubChem CID | 26956955 |
| Molecular Formula | C17H13BrN4OS |
| Molecular Weight | 401.29 g/mol |
| Exact Mass | 400.00 |
| IUPAC Name | 1-(3-bromophenyl)-3-(quinoline-2-carbonylamino)thiourea |
| SMILES | O=C(NNC(=S)Nc1cccc(Br)c1)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C17H13BrN4OS/c18-12-5-3-6-13(10-12)19-17(24)22-21-16(23)15-9-8-11-4-1-2-7-14(11)20-15/h1-10H,(H,21,23)(H2,19,22,24) |
| InChIKey | VOPMFNOMQGKTJW-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.29 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|