C15H12BrN5OS — CID 91647418
1-(3-bromophenyl)-3-(imidazo[1,2-a]pyridine-2-carbonylamino)thiourea (PubChem CID 91647418) has the molecular formula C15H12BrN5OS and a molecular weight of 390.27 g/mol. Its IUPAC name is 1-(3-bromophenyl)-3-(imidazo[1,2-a]pyridine-2-carbonylamino)thiourea.
| Compound Name | 1-(3-bromophenyl)-3-(imidazo[1,2-a]pyridine-2-carbonylamino)thiourea |
|---|---|
| PubChem CID | 91647418 |
| Molecular Formula | C15H12BrN5OS |
| Molecular Weight | 390.27 g/mol |
| Exact Mass | 388.99 |
| IUPAC Name | 1-(3-bromophenyl)-3-(imidazo[1,2-a]pyridine-2-carbonylamino)thiourea |
| SMILES | O=C(NNC(=S)Nc1cccc(Br)c1)c1cn2ccccc2n1 |
| InChI | InChI=1S/C15H12BrN5OS/c16-10-4-3-5-11(8-10)17-15(23)20-19-14(22)12-9-21-7-2-1-6-13(21)18-12/h1-9H,(H,19,22)(H2,17,20,23) |
| InChIKey | XNKFHBNEJNHRBE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 70.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.27 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|