C21H20N4O3S — CID 29266626
N-(3-methylphenyl)-2-[2-oxo-2-[2-(quinoline-2-carbonyl)hydrazinyl]ethyl]sulfanylacetamide (PubChem CID 29266626) has the molecular formula C21H20N4O3S and a molecular weight of 408.48 g/mol. Its IUPAC name is N-(3-methylphenyl)-2-[2-oxo-2-[2-(quinoline-2-carbonyl)hydrazinyl]ethyl]sulfanylacetamide.
| Compound Name | N-(3-methylphenyl)-2-[2-oxo-2-[2-(quinoline-2-carbonyl)hydrazinyl]ethyl]sulfanylacetamide |
|---|---|
| PubChem CID | 29266626 |
| Molecular Formula | C21H20N4O3S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | N-(3-methylphenyl)-2-[2-oxo-2-[2-(quinoline-2-carbonyl)hydrazinyl]ethyl]sulfanylacetamide |
| SMILES | Cc1cccc(NC(=O)CSCC(=O)NNC(=O)c2ccc3ccccc3n2)c1 |
| InChI | InChI=1S/C21H20N4O3S/c1-14-5-4-7-16(11-14)22-19(26)12-29-13-20(27)24-25-21(28)18-10-9-15-6-2-3-8-17(15)23-18/h2-11H,12-13H2,1H3,(H,22,26)(H,24,27)(H,25,28) |
| InChIKey | NTWVZDFHRLNPEF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|