C28H20N6O3S — CID 74834541
N-[(5-acetyl-3-phenyl-1,3,4-thiadiazol-2-ylidene)amino]-5-(1-benzofuran-2-yl)-1-phenylpyrazole-3-carboxamide (PubChem CID 74834541) has the molecular formula C28H20N6O3S and a molecular weight of 520.57 g/mol. Its IUPAC name is N-[(5-acetyl-3-phenyl-1,3,4-thiadiazol-2-ylidene)amino]-5-(1-benzofuran-2-yl)-1-phenylpyrazole-3-carboxamide.
| Compound Name | N-[(5-acetyl-3-phenyl-1,3,4-thiadiazol-2-ylidene)amino]-5-(1-benzofuran-2-yl)-1-phenylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 74834541 |
| Molecular Formula | C28H20N6O3S |
| Molecular Weight | 520.57 g/mol |
| Exact Mass | 520.13 |
| IUPAC Name | N-[(5-acetyl-3-phenyl-1,3,4-thiadiazol-2-ylidene)amino]-5-(1-benzofuran-2-yl)-1-phenylpyrazole-3-carboxamide |
| SMILES | CC(=O)c1nn(-c2ccccc2)c(=NNC(=O)c2cc(-c3cc4ccccc4o3)n(-c3ccccc3)n2)s1 |
| InChI | InChI=1S/C28H20N6O3S/c1-18(35)27-32-34(21-13-6-3-7-14-21)28(38-27)30-29-26(36)22-17-23(33(31-22)20-11-4-2-5-12-20)25-16-19-10-8-9-15-24(19)37-25/h2-17H,1H3,(H,29,36) |
| InChIKey | VLUCUYKOLNKGDA-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 107.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.57 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|