C25H18N4OS — CID 100932782
naphthalen-2-yl-[(5E)-4-phenyl-5-(phenylhydrazinylidene)-1,3,4-thiadiazol-2-yl]methanone (PubChem CID 100932782) has the molecular formula C25H18N4OS and a molecular weight of 422.51 g/mol. Its IUPAC name is naphthalen-2-yl-[(5E)-4-phenyl-5-(phenylhydrazinylidene)-1,3,4-thiadiazol-2-yl]methanone.
| Compound Name | naphthalen-2-yl-[(5E)-4-phenyl-5-(phenylhydrazinylidene)-1,3,4-thiadiazol-2-yl]methanone |
|---|---|
| PubChem CID | 100932782 |
| Molecular Formula | C25H18N4OS |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | naphthalen-2-yl-[(5E)-4-phenyl-5-(phenylhydrazinylidene)-1,3,4-thiadiazol-2-yl]methanone |
| SMILES | O=C(c1ccc2ccccc2c1)c1nn(-c2ccccc2)/c(=N\Nc2ccccc2)s1 |
| InChI | InChI=1S/C25H18N4OS/c30-23(20-16-15-18-9-7-8-10-19(18)17-20)24-28-29(22-13-5-2-6-14-22)25(31-24)27-26-21-11-3-1-4-12-21/h1-17,26H/b27-25+ |
| InChIKey | UEYREDYZNBJSSN-IMVLJIQESA-N |
| XLogP | 5.25 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|