C27H20N4OS — CID 177475365
naphthalen-2-yl-[(5E)-4-phenyl-5-[(E)-1-phenylethylidenehydrazinylidene]-1,3,4-thiadiazol-2-yl]methanone (PubChem CID 177475365) has the molecular formula C27H20N4OS and a molecular weight of 448.55 g/mol. Its IUPAC name is naphthalen-2-yl-[(5E)-4-phenyl-5-[(E)-1-phenylethylidenehydrazinylidene]-1,3,4-thiadiazol-2-yl]methanone.
| Compound Name | naphthalen-2-yl-[(5E)-4-phenyl-5-[(E)-1-phenylethylidenehydrazinylidene]-1,3,4-thiadiazol-2-yl]methanone |
|---|---|
| PubChem CID | 177475365 |
| Molecular Formula | C27H20N4OS |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | naphthalen-2-yl-[(5E)-4-phenyl-5-[(E)-1-phenylethylidenehydrazinylidene]-1,3,4-thiadiazol-2-yl]methanone |
| SMILES | C/C(=N\N=c1\sc(C(=O)c2ccc3ccccc3c2)nn1-c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H20N4OS/c1-19(20-10-4-2-5-11-20)28-29-27-31(24-14-6-3-7-15-24)30-26(33-27)25(32)23-17-16-21-12-8-9-13-22(21)18-23/h2-18H,1H3/b28-19+,29-27+ |
| InChIKey | ZTYGFKGCMLCEJO-CJJYVHHKSA-N |
| XLogP | 5.64 |
| TPSA | 59.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|