C29H24N6O2S — CID 137228425
4-[[4-[C-methyl-N-[[5-(4-methylphenyl)-3-phenyl-1,3,4-thiadiazol-2-ylidene]amino]carbonimidoyl]phenyl]diazenyl]benzene-1,3-diol (PubChem CID 137228425) has the molecular formula C29H24N6O2S and a molecular weight of 520.62 g/mol. Its IUPAC name is 4-[[4-[C-methyl-N-[[5-(4-methylphenyl)-3-phenyl-1,3,4-thiadiazol-2-ylidene]amino]carbonimidoyl]phenyl]diazenyl]benzene-1,3-diol.
| Compound Name | 4-[[4-[C-methyl-N-[[5-(4-methylphenyl)-3-phenyl-1,3,4-thiadiazol-2-ylidene]amino]carbonimidoyl]phenyl]diazenyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 137228425 |
| Molecular Formula | C29H24N6O2S |
| Molecular Weight | 520.62 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | 4-[[4-[C-methyl-N-[[5-(4-methylphenyl)-3-phenyl-1,3,4-thiadiazol-2-ylidene]amino]carbonimidoyl]phenyl]diazenyl]benzene-1,3-diol |
| SMILES | CC(=NN=c1sc(-c2ccc(C)cc2)nn1-c1ccccc1)c1ccc(/N=N/c2ccc(O)cc2O)cc1 |
| InChI | InChI=1S/C29H24N6O2S/c1-19-8-10-22(11-9-19)28-34-35(24-6-4-3-5-7-24)29(38-28)33-30-20(2)21-12-14-23(15-13-21)31-32-26-17-16-25(36)18-27(26)37/h3-18,36-37H,1-2H3/b30-20?,32-31+,33-29? |
| InChIKey | LKMRXFSRIMPEKC-CDTCEZHDSA-N |
| XLogP | 7.06 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.62 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|