C24H23N5O6S2 — CID 164618454
1-(4-sulfamoylphenyl)-5-thiophen-2-yl-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]pyrazole-3-carboxamide (PubChem CID 164618454) has the molecular formula C24H23N5O6S2 and a molecular weight of 541.61 g/mol. Its IUPAC name is 1-(4-sulfamoylphenyl)-5-thiophen-2-yl-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]pyrazole-3-carboxamide.
| Compound Name | 1-(4-sulfamoylphenyl)-5-thiophen-2-yl-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 164618454 |
| Molecular Formula | C24H23N5O6S2 |
| Molecular Weight | 541.61 g/mol |
| Exact Mass | 541.11 |
| IUPAC Name | 1-(4-sulfamoylphenyl)-5-thiophen-2-yl-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]pyrazole-3-carboxamide |
| SMILES | COc1cc(/C=N\NC(=O)c2cc(-c3cccs3)n(-c3ccc(S(N)(=O)=O)cc3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C24H23N5O6S2/c1-33-20-11-15(12-21(34-2)23(20)35-3)14-26-27-24(30)18-13-19(22-5-4-10-36-22)29(28-18)16-6-8-17(9-7-16)37(25,31)32/h4-14H,1-3H3,(H,27,30)(H2,25,31,32)/b26-14- |
| InChIKey | RMLWWPVSZOCLDN-WGARJPEWSA-N |
| XLogP | 3.04 |
| TPSA | 147.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.61 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|