C22H19N5O5S2 — CID 164628544
N-[(Z)-(3-hydroxy-4-methoxyphenyl)methylideneamino]-1-(4-sulfamoylphenyl)-5-thiophen-2-ylpyrazole-3-carboxamide (PubChem CID 164628544) has the molecular formula C22H19N5O5S2 and a molecular weight of 497.56 g/mol. Its IUPAC name is N-[(Z)-(3-hydroxy-4-methoxyphenyl)methylideneamino]-1-(4-sulfamoylphenyl)-5-thiophen-2-ylpyrazole-3-carboxamide.
| Compound Name | N-[(Z)-(3-hydroxy-4-methoxyphenyl)methylideneamino]-1-(4-sulfamoylphenyl)-5-thiophen-2-ylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 164628544 |
| Molecular Formula | C22H19N5O5S2 |
| Molecular Weight | 497.56 g/mol |
| Exact Mass | 497.08 |
| IUPAC Name | N-[(Z)-(3-hydroxy-4-methoxyphenyl)methylideneamino]-1-(4-sulfamoylphenyl)-5-thiophen-2-ylpyrazole-3-carboxamide |
| SMILES | COc1ccc(/C=N\NC(=O)c2cc(-c3cccs3)n(-c3ccc(S(N)(=O)=O)cc3)n2)cc1O |
| InChI | InChI=1S/C22H19N5O5S2/c1-32-20-9-4-14(11-19(20)28)13-24-25-22(29)17-12-18(21-3-2-10-33-21)27(26-17)15-5-7-16(8-6-15)34(23,30)31/h2-13,28H,1H3,(H,25,29)(H2,23,30,31)/b24-13- |
| InChIKey | TWSVOQDMZLWAFP-CFRMEGHHSA-N |
| XLogP | 2.73 |
| TPSA | 148.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.56 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|