C25H30N2O4S — CID 24895709
ethyl 2-methyl-5-(4-pentylphenyl)-1-(4-sulfamoylphenyl)pyrrole-3-carboxylate (PubChem CID 24895709) has the molecular formula C25H30N2O4S and a molecular weight of 454.59 g/mol. Its IUPAC name is ethyl 2-methyl-5-(4-pentylphenyl)-1-(4-sulfamoylphenyl)pyrrole-3-carboxylate.
| Compound Name | ethyl 2-methyl-5-(4-pentylphenyl)-1-(4-sulfamoylphenyl)pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 24895709 |
| Molecular Formula | C25H30N2O4S |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | ethyl 2-methyl-5-(4-pentylphenyl)-1-(4-sulfamoylphenyl)pyrrole-3-carboxylate |
| SMILES | CCCCCc1ccc(-c2cc(C(=O)OCC)c(C)n2-c2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C25H30N2O4S/c1-4-6-7-8-19-9-11-20(12-10-19)24-17-23(25(28)31-5-2)18(3)27(24)21-13-15-22(16-14-21)32(26,29)30/h9-17H,4-8H2,1-3H3,(H2,26,29,30) |
| InChIKey | XUKRXCQJGVGNRO-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 91.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|