C23H25ClN2O3 — CID 7306923
1-(2-chlorophenyl)-5-(4-methoxyphenyl)-N-(3-methoxypropyl)-2-methylpyrrole-3-carboxamide (PubChem CID 7306923) has the molecular formula C23H25ClN2O3 and a molecular weight of 412.92 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-5-(4-methoxyphenyl)-N-(3-methoxypropyl)-2-methylpyrrole-3-carboxamide.
| Compound Name | 1-(2-chlorophenyl)-5-(4-methoxyphenyl)-N-(3-methoxypropyl)-2-methylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 7306923 |
| Molecular Formula | C23H25ClN2O3 |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 1-(2-chlorophenyl)-5-(4-methoxyphenyl)-N-(3-methoxypropyl)-2-methylpyrrole-3-carboxamide |
| SMILES | COCCCNC(=O)c1cc(-c2ccc(OC)cc2)n(-c2ccccc2Cl)c1C |
| InChI | InChI=1S/C23H25ClN2O3/c1-16-19(23(27)25-13-6-14-28-2)15-22(17-9-11-18(29-3)12-10-17)26(16)21-8-5-4-7-20(21)24/h4-5,7-12,15H,6,13-14H2,1-3H3,(H,25,27) |
| InChIKey | CYXTWUDIZNURGA-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|