C35H31ClFN3O — CID 46126567
(4-benzhydrylpiperazin-1-yl)-[5-(4-chlorophenyl)-1-(2-fluorophenyl)-2-methylpyrrol-3-yl]methanone (PubChem CID 46126567) has the molecular formula C35H31ClFN3O and a molecular weight of 564.10 g/mol. Its IUPAC name is (4-benzhydrylpiperazin-1-yl)-[5-(4-chlorophenyl)-1-(2-fluorophenyl)-2-methylpyrrol-3-yl]methanone.
| Compound Name | (4-benzhydrylpiperazin-1-yl)-[5-(4-chlorophenyl)-1-(2-fluorophenyl)-2-methylpyrrol-3-yl]methanone |
|---|---|
| PubChem CID | 46126567 |
| Molecular Formula | C35H31ClFN3O |
| Molecular Weight | 564.10 g/mol |
| Exact Mass | 563.21 |
| IUPAC Name | (4-benzhydrylpiperazin-1-yl)-[5-(4-chlorophenyl)-1-(2-fluorophenyl)-2-methylpyrrol-3-yl]methanone |
| SMILES | Cc1c(C(=O)N2CCN(C(c3ccccc3)c3ccccc3)CC2)cc(-c2ccc(Cl)cc2)n1-c1ccccc1F |
| InChI | InChI=1S/C35H31ClFN3O/c1-25-30(24-33(26-16-18-29(36)19-17-26)40(25)32-15-9-8-14-31(32)37)35(41)39-22-20-38(21-23-39)34(27-10-4-2-5-11-27)28-12-6-3-7-13-28/h2-19,24,34H,20-23H2,1H3 |
| InChIKey | IFCGFBMFIGWFMD-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.10 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|