C25H27ClN2O — CID 7213356
[5-(4-chlorophenyl)-2-methyl-1-(2-methylphenyl)pyrrol-3-yl]-(4-methylpiperidin-1-yl)methanone (PubChem CID 7213356) has the molecular formula C25H27ClN2O and a molecular weight of 406.96 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-2-methyl-1-(2-methylphenyl)pyrrol-3-yl]-(4-methylpiperidin-1-yl)methanone.
| Compound Name | [5-(4-chlorophenyl)-2-methyl-1-(2-methylphenyl)pyrrol-3-yl]-(4-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 7213356 |
| Molecular Formula | C25H27ClN2O |
| Molecular Weight | 406.96 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | [5-(4-chlorophenyl)-2-methyl-1-(2-methylphenyl)pyrrol-3-yl]-(4-methylpiperidin-1-yl)methanone |
| SMILES | Cc1ccccc1-n1c(-c2ccc(Cl)cc2)cc(C(=O)N2CCC(C)CC2)c1C |
| InChI | InChI=1S/C25H27ClN2O/c1-17-12-14-27(15-13-17)25(29)22-16-24(20-8-10-21(26)11-9-20)28(19(22)3)23-7-5-4-6-18(23)2/h4-11,16-17H,12-15H2,1-3H3 |
| InChIKey | BDLPXUNRVJCPTR-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.96 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|