C19H27N3O2 — CID 110812326
N-cyclopentyl-4-(2,4-dimethylbenzoyl)piperazine-1-carboxamide (PubChem CID 110812326) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is N-cyclopentyl-4-(2,4-dimethylbenzoyl)piperazine-1-carboxamide.
| Compound Name | N-cyclopentyl-4-(2,4-dimethylbenzoyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 110812326 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | N-cyclopentyl-4-(2,4-dimethylbenzoyl)piperazine-1-carboxamide |
| SMILES | Cc1ccc(C(=O)N2CCN(C(=O)NC3CCCC3)CC2)c(C)c1 |
| InChI | InChI=1S/C19H27N3O2/c1-14-7-8-17(15(2)13-14)18(23)21-9-11-22(12-10-21)19(24)20-16-5-3-4-6-16/h7-8,13,16H,3-6,9-12H2,1-2H3,(H,20,24) |
| InChIKey | GOHLFAAYENEMAR-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |