C22H33N3O2 — CID 110813819
N-cyclohexyl-4-[2-(2,4-dimethylphenyl)acetyl]-1,4-diazepane-1-carboxamide (PubChem CID 110813819) has the molecular formula C22H33N3O2 and a molecular weight of 371.53 g/mol. Its IUPAC name is N-cyclohexyl-4-[2-(2,4-dimethylphenyl)acetyl]-1,4-diazepane-1-carboxamide.
| Compound Name | N-cyclohexyl-4-[2-(2,4-dimethylphenyl)acetyl]-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 110813819 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | N-cyclohexyl-4-[2-(2,4-dimethylphenyl)acetyl]-1,4-diazepane-1-carboxamide |
| SMILES | Cc1ccc(CC(=O)N2CCCN(C(=O)NC3CCCCC3)CC2)c(C)c1 |
| InChI | InChI=1S/C22H33N3O2/c1-17-9-10-19(18(2)15-17)16-21(26)24-11-6-12-25(14-13-24)22(27)23-20-7-4-3-5-8-20/h9-10,15,20H,3-8,11-14,16H2,1-2H3,(H,23,27) |
| InChIKey | IOBQBTQUYVTZDZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |