C20H29N3O2 — CID 110812610
N-cyclopentyl-4-(2,4,5-trimethylbenzoyl)piperazine-1-carboxamide (PubChem CID 110812610) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is N-cyclopentyl-4-(2,4,5-trimethylbenzoyl)piperazine-1-carboxamide.
| Compound Name | N-cyclopentyl-4-(2,4,5-trimethylbenzoyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 110812610 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | N-cyclopentyl-4-(2,4,5-trimethylbenzoyl)piperazine-1-carboxamide |
| SMILES | Cc1cc(C)c(C(=O)N2CCN(C(=O)NC3CCCC3)CC2)cc1C |
| InChI | InChI=1S/C20H29N3O2/c1-14-12-16(3)18(13-15(14)2)19(24)22-8-10-23(11-9-22)20(25)21-17-6-4-5-7-17/h12-13,17H,4-11H2,1-3H3,(H,21,25) |
| InChIKey | DFHNPNHYAYEUHN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |