C18H24N2O2 — CID 110800460
cyclopropyl-[4-(2,4,5-trimethylbenzoyl)piperazin-1-yl]methanone (PubChem CID 110800460) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is cyclopropyl-[4-(2,4,5-trimethylbenzoyl)piperazin-1-yl]methanone.
| Compound Name | cyclopropyl-[4-(2,4,5-trimethylbenzoyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 110800460 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | cyclopropyl-[4-(2,4,5-trimethylbenzoyl)piperazin-1-yl]methanone |
| SMILES | Cc1cc(C)c(C(=O)N2CCN(C(=O)C3CC3)CC2)cc1C |
| InChI | InChI=1S/C18H24N2O2/c1-12-10-14(3)16(11-13(12)2)18(22)20-8-6-19(7-9-20)17(21)15-4-5-15/h10-11,15H,4-9H2,1-3H3 |
| InChIKey | IXWIPXJTUXDPQM-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |