C20H28N2O2 — CID 110809344
cyclobutyl-[4-(2,4,5-trimethylbenzoyl)-1,4-diazepan-1-yl]methanone (PubChem CID 110809344) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is cyclobutyl-[4-(2,4,5-trimethylbenzoyl)-1,4-diazepan-1-yl]methanone.
| Compound Name | cyclobutyl-[4-(2,4,5-trimethylbenzoyl)-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 110809344 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | cyclobutyl-[4-(2,4,5-trimethylbenzoyl)-1,4-diazepan-1-yl]methanone |
| SMILES | Cc1cc(C)c(C(=O)N2CCCN(C(=O)C3CCC3)CC2)cc1C |
| InChI | InChI=1S/C20H28N2O2/c1-14-12-16(3)18(13-15(14)2)20(24)22-9-5-8-21(10-11-22)19(23)17-6-4-7-17/h12-13,17H,4-11H2,1-3H3 |
| InChIKey | RVPCYSSZRQTJFK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |