C32H33FN4O3 — CID 42789141
N-(4-ethylphenyl)-4-[1-(2-fluorophenyl)-5-(3-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazine-1-carboxamide (PubChem CID 42789141) has the molecular formula C32H33FN4O3 and a molecular weight of 540.64 g/mol. Its IUPAC name is N-(4-ethylphenyl)-4-[1-(2-fluorophenyl)-5-(3-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazine-1-carboxamide.
| Compound Name | N-(4-ethylphenyl)-4-[1-(2-fluorophenyl)-5-(3-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 42789141 |
| Molecular Formula | C32H33FN4O3 |
| Molecular Weight | 540.64 g/mol |
| Exact Mass | 540.25 |
| IUPAC Name | N-(4-ethylphenyl)-4-[1-(2-fluorophenyl)-5-(3-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazine-1-carboxamide |
| SMILES | CCc1ccc(NC(=O)N2CCN(C(=O)c3cc(-c4cccc(OC)c4)n(-c4ccccc4F)c3C)CC2)cc1 |
| InChI | InChI=1S/C32H33FN4O3/c1-4-23-12-14-25(15-13-23)34-32(39)36-18-16-35(17-19-36)31(38)27-21-30(24-8-7-9-26(20-24)40-3)37(22(27)2)29-11-6-5-10-28(29)33/h5-15,20-21H,4,16-19H2,1-3H3,(H,34,39) |
| InChIKey | DZMMKLWXWGBJSY-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.64 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|