C30H27Cl2FN4O3 — CID 5129909
N-(2,4-dichlorophenyl)-4-[1-(2-fluorophenyl)-5-(3-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazine-1-carboxamide (PubChem CID 5129909) has the molecular formula C30H27Cl2FN4O3 and a molecular weight of 581.48 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-4-[1-(2-fluorophenyl)-5-(3-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazine-1-carboxamide.
| Compound Name | N-(2,4-dichlorophenyl)-4-[1-(2-fluorophenyl)-5-(3-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 5129909 |
| Molecular Formula | C30H27Cl2FN4O3 |
| Molecular Weight | 581.48 g/mol |
| Exact Mass | 580.14 |
| IUPAC Name | N-(2,4-dichlorophenyl)-4-[1-(2-fluorophenyl)-5-(3-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazine-1-carboxamide |
| SMILES | COc1cccc(-c2cc(C(=O)N3CCN(C(=O)Nc4ccc(Cl)cc4Cl)CC3)c(C)n2-c2ccccc2F)c1 |
| InChI | InChI=1S/C30H27Cl2FN4O3/c1-19-23(18-28(20-6-5-7-22(16-20)40-2)37(19)27-9-4-3-8-25(27)33)29(38)35-12-14-36(15-13-35)30(39)34-26-11-10-21(31)17-24(26)32/h3-11,16-18H,12-15H2,1-2H3,(H,34,39) |
| InChIKey | QSFHEHUTNSDDLX-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.48 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|