C26H32N3O2+ — CID 7231138
5-(4-methoxyphenyl)-2-methyl-1-phenyl-N-(2-piperidin-1-ium-1-ylethyl)pyrrole-3-carboxamide (PubChem CID 7231138) has the molecular formula C26H32N3O2+ and a molecular weight of 418.56 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-2-methyl-1-phenyl-N-(2-piperidin-1-ium-1-ylethyl)pyrrole-3-carboxamide.
| Compound Name | 5-(4-methoxyphenyl)-2-methyl-1-phenyl-N-(2-piperidin-1-ium-1-ylethyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 7231138 |
| Molecular Formula | C26H32N3O2+ |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | 5-(4-methoxyphenyl)-2-methyl-1-phenyl-N-(2-piperidin-1-ium-1-ylethyl)pyrrole-3-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)NCC[NH+]3CCCCC3)c(C)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H31N3O2/c1-20-24(26(30)27-15-18-28-16-7-4-8-17-28)19-25(21-11-13-23(31-2)14-12-21)29(20)22-9-5-3-6-10-22/h3,5-6,9-14,19H,4,7-8,15-18H2,1-2H3,(H,27,30)/p+1 |
| InChIKey | AOSSMJLYFHFCDL-UHFFFAOYSA-O |
| XLogP | 3.26 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|