C11H16Cl2N2O2 — CID 119651425
(5-chlorofuran-2-yl)-[2-(methylaminomethyl)pyrrolidin-1-yl]methanone;hydrochloride (PubChem CID 119651425) has the molecular formula C11H16Cl2N2O2 and a molecular weight of 279.17 g/mol. Its IUPAC name is (5-chlorofuran-2-yl)-[2-(methylaminomethyl)pyrrolidin-1-yl]methanone;hydrochloride.
| Compound Name | (5-chlorofuran-2-yl)-[2-(methylaminomethyl)pyrrolidin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119651425 |
| Molecular Formula | C11H16Cl2N2O2 |
| Molecular Weight | 279.17 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | (5-chlorofuran-2-yl)-[2-(methylaminomethyl)pyrrolidin-1-yl]methanone;hydrochloride |
| SMILES | CNCC1CCCN1C(=O)c1ccc(Cl)o1.Cl |
| InChI | InChI=1S/C11H15ClN2O2.ClH/c1-13-7-8-3-2-6-14(8)11(15)9-4-5-10(12)16-9;/h4-5,8,13H,2-3,6-7H2,1H3;1H |
| InChIKey | JSAGFANDVFDRNQ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.17 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |