C15H22BrClN2O — CID 119651279
3-(4-bromophenyl)-1-[2-(methylaminomethyl)pyrrolidin-1-yl]propan-1-one;hydrochloride (PubChem CID 119651279) has the molecular formula C15H22BrClN2O and a molecular weight of 361.71 g/mol. Its IUPAC name is 3-(4-bromophenyl)-1-[2-(methylaminomethyl)pyrrolidin-1-yl]propan-1-one;hydrochloride.
| Compound Name | 3-(4-bromophenyl)-1-[2-(methylaminomethyl)pyrrolidin-1-yl]propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119651279 |
| Molecular Formula | C15H22BrClN2O |
| Molecular Weight | 361.71 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | 3-(4-bromophenyl)-1-[2-(methylaminomethyl)pyrrolidin-1-yl]propan-1-one;hydrochloride |
| SMILES | CNCC1CCCN1C(=O)CCc1ccc(Br)cc1.Cl |
| InChI | InChI=1S/C15H21BrN2O.ClH/c1-17-11-14-3-2-10-18(14)15(19)9-6-12-4-7-13(16)8-5-12;/h4-5,7-8,14,17H,2-3,6,9-11H2,1H3;1H |
| InChIKey | OPRUMVAUNOGGFJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.71 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |