C16H22F2N2O2 — CID 119651072
3-[4-(difluoromethoxy)phenyl]-1-[2-(methylaminomethyl)pyrrolidin-1-yl]propan-1-one (PubChem CID 119651072) has the molecular formula C16H22F2N2O2 and a molecular weight of 312.36 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)phenyl]-1-[2-(methylaminomethyl)pyrrolidin-1-yl]propan-1-one.
| Compound Name | 3-[4-(difluoromethoxy)phenyl]-1-[2-(methylaminomethyl)pyrrolidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 119651072 |
| Molecular Formula | C16H22F2N2O2 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 3-[4-(difluoromethoxy)phenyl]-1-[2-(methylaminomethyl)pyrrolidin-1-yl]propan-1-one |
| SMILES | CNCC1CCCN1C(=O)CCc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C16H22F2N2O2/c1-19-11-13-3-2-10-20(13)15(21)9-6-12-4-7-14(8-5-12)22-16(17)18/h4-5,7-8,13,16,19H,2-3,6,9-11H2,1H3 |
| InChIKey | VSNVQABIBNIULI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |