C25H37N7O3 — CID 163526328
1-[7-[1-amino-3-[2-[bis(2-methoxyethyl)amino]ethylimino]prop-1-en-2-yl]-1,5-naphthyridin-2-yl]-3-cyclopentylurea (PubChem CID 163526328) has the molecular formula C25H37N7O3 and a molecular weight of 483.62 g/mol. Its IUPAC name is 1-[7-[1-amino-3-[2-[bis(2-methoxyethyl)amino]ethylimino]prop-1-en-2-yl]-1,5-naphthyridin-2-yl]-3-cyclopentylurea.
| Compound Name | 1-[7-[1-amino-3-[2-[bis(2-methoxyethyl)amino]ethylimino]prop-1-en-2-yl]-1,5-naphthyridin-2-yl]-3-cyclopentylurea |
|---|---|
| PubChem CID | 163526328 |
| Molecular Formula | C25H37N7O3 |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.30 |
| IUPAC Name | 1-[7-[1-amino-3-[2-[bis(2-methoxyethyl)amino]ethylimino]prop-1-en-2-yl]-1,5-naphthyridin-2-yl]-3-cyclopentylurea |
| SMILES | COCCN(CC/N=C/C(=CN)c1cnc2ccc(NC(=O)NC3CCCC3)nc2c1)CCOC |
| InChI | InChI=1S/C25H37N7O3/c1-34-13-11-32(12-14-35-2)10-9-27-17-20(16-26)19-15-23-22(28-18-19)7-8-24(30-23)31-25(33)29-21-5-3-4-6-21/h7-8,15-18,21H,3-6,9-14,26H2,1-2H3,(H2,29,30,31,33)/b20-16?,27-17+ |
| InChIKey | QROJKDYBZGUYGL-QPGAFHGISA-N |
| XLogP | 2.66 |
| TPSA | 126.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|