C19H19N5O2 — CID 90164218
1-cyclopentyl-3-[7-(2-oxo-1H-pyridin-4-yl)-1,5-naphthyridin-2-yl]urea (PubChem CID 90164218) has the molecular formula C19H19N5O2 and a molecular weight of 349.39 g/mol. Its IUPAC name is 1-cyclopentyl-3-[7-(2-oxo-1H-pyridin-4-yl)-1,5-naphthyridin-2-yl]urea.
| Compound Name | 1-cyclopentyl-3-[7-(2-oxo-1H-pyridin-4-yl)-1,5-naphthyridin-2-yl]urea |
|---|---|
| PubChem CID | 90164218 |
| Molecular Formula | C19H19N5O2 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 1-cyclopentyl-3-[7-(2-oxo-1H-pyridin-4-yl)-1,5-naphthyridin-2-yl]urea |
| SMILES | O=C(Nc1ccc2ncc(-c3cc[nH]c(=O)c3)cc2n1)NC1CCCC1 |
| InChI | InChI=1S/C19H19N5O2/c25-18-10-12(7-8-20-18)13-9-16-15(21-11-13)5-6-17(23-16)24-19(26)22-14-3-1-2-4-14/h5-11,14H,1-4H2,(H,20,25)(H2,22,23,24,26) |
| InChIKey | GTFJTFBJHBMHQR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |